Molecular Definition

Canonical SMILES [Br-].CC[N+]1(CCOC(=O)C(O)(c2ccccc2)c3ccccc3)CCCCC1
Formula C23H30BrNO3
Molecular Weight 448.39 da
Stereocenters 0/1