Molecular Definition

Canonical SMILES NC(=O)N1C(=O)\C(=C(/O)\c2cccs2)\c3cc(Cl)ccc13
Formula C14H9ClN2O3S
Molecular Weight 320.75 da
Stereocenters 0/0