Target Relevance

Nischarin Tclin
pKi 70819 6.23

Molecular Definition

Canonical SMILES C[C@H](CC1=NCCN1)c2ccccc2
Formula C12H16N2
Molecular Weight 188.27 da
Stereocenters 1/1