Target Relevance

Molecular Definition

Canonical SMILES CN(C)c1ccc(cc1)[C@@H]2CN(N=C2c3ccc(Cl)c(Cl)c3)S(=O)(=O)c4ccc(Cl)cc4
Formula C23H20Cl3N3O2S
Molecular Weight 508.85 da
Stereocenters 1/1