Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](CC1CCCCC1)OC(=O)NN(C)C#N
Formula C12H21N3O2
Molecular Weight 239.31 da
Stereocenters 1/1