Molecular Definition

Canonical SMILES Brc1ccc(CNc2nccc(n2)c3ccc4OCOc4c3)cc1Br
Formula C18H13Br2N3O2
Molecular Weight 463.12 da
Stereocenters 0/0