Target Relevance

Molecular Definition

Canonical SMILES Oc1cc(Br)c(Br)c2Oc3c(Br)cc(Br)cc3Oc12
Formula C12H4Br4O3
Molecular Weight 515.77 da
Stereocenters 0/0