Target Relevance

Molecular Definition

Canonical SMILES Oc1cc(Br)cc2Oc3c(Br)cc(Br)cc3Oc12
Formula C12H5Br3O3
Molecular Weight 436.88 da
Stereocenters 0/0