Molecular Definition

Canonical SMILES COc1ccc(cc1)n2cc(nc2c3ccccc3)C(=O)NCCCN4CCN(CC4)c5cccc(C)c5C
Formula C32H37N5O2
Molecular Weight 523.67 da
Stereocenters 0/0