Target Relevance

Molecular Definition

Canonical SMILES C[C@H](CCC(=O)NCC(=O)O)C1CCC2C3CCC4Cc5nn(CCO)cc5C[C@]4(C)C3CC[C@]12C
Formula C29H45N3O4
Molecular Weight 499.69 da
Stereocenters 3/8