Molecular Definition

Canonical SMILES NC(=O)c1cnc(NC(C2CC2)C3CC3)c4c5ccc(cc5[nH]c14)c6cnc(N)nc6
Formula C23H23N7O
Molecular Weight 413.48 da
Stereocenters 0/0