Molecular Definition

Canonical SMILES O[C@@H](CNCCOCCOCCNC(=O)CCCCCNC(=O)COc1ccc(\C=C\c2ccc3C=C4C=CC(=[N+]4[B-](F)(F)n23)c5cccs5)cc1)COc6ccccc6CC=C
Formula C47H56BF2N5O7S
Molecular Weight 883.85 da
Stereocenters 1/1