Molecular Definition

Canonical SMILES OC(CNCCNC(=O)CCCCCNC(=O)COc1ccc(\C=C\c2ccc3C=C4C=CC(=[N+]4[B-](F)(F)n23)c5cccs5)cc1)COc6cccc7ccccc67
Formula C44H46BF2N5O5S
Molecular Weight 805.74 da
Stereocenters 0/1