Molecular Definition

Canonical SMILES c1ccc(nc1)c2n[nH]cc2c3ccnc(c3)n4cccn4
Formula C16H12N6
Molecular Weight 288.31 da
Stereocenters 0/0