Molecular Definition

Canonical SMILES COc1cc2c(NC3CCN(CC3)C(C)C)nc(nc2cc1OCCCN4CCCC4)N5CCCN(CC5)C(C)C
Formula C32H53N7O2
Molecular Weight 567.81 da
Stereocenters 0/0