Molecular Definition

Canonical SMILES CCN1CCCN(CC1)c2nc(NC3CCN(CC3)C(C)C)c4cc(OC)c(OCCCN5CCCC5)cc4n2
Formula C31H51N7O2
Molecular Weight 553.78 da
Stereocenters 0/0