Molecular Definition

Canonical SMILES COc1cc2c(NC3CCN(CC3)C(C)C)nc(nc2cc1OCCCN4CCCC4)N5CCCN(C)CC5
Formula C30H49N7O2
Molecular Weight 539.76 da
Stereocenters 0/0