Molecular Definition

Canonical SMILES Cn1cc(cn1)c2cc(ccn2)c3c[nH]nc3c4ccccn4
Formula C17H14N6
Molecular Weight 302.33 da
Stereocenters 0/0