Molecular Definition

Canonical SMILES CCCc1cc(ccn1)c2nc(cs2)c3ccc(NS(=O)(=O)C)cc3
Formula C18H19N3O2S2
Molecular Weight 373.49 da
Stereocenters 0/0