Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2nn(CC(=S)Nc3cccc(c3)C#N)cc2c4ccc5nccnc5c4
Formula C26H19N7S
Molecular Weight 461.54 da
Stereocenters 0/0