Molecular Definition

Canonical SMILES CCNC(=O)NC[C@@H]1C[C@H]1c2c(Cl)ccc3O[C@H](CCCCc4ccccc4)Cc23
Formula C25H31ClN2O2
Molecular Weight 426.98 da
Stereocenters 3/3