Target Relevance

Molecular Definition

Canonical SMILES CN1C[C@@H](COc2ccc(cc2C)C(=O)n3c(C)c(CC(=O)O)c4ccccc34)Oc5ccccc15
Formula C29H28N2O5
Molecular Weight 484.54 da
Stereocenters 1/1