Target Relevance

Molecular Definition

Canonical SMILES CN1C[C@@H](COc2ccc(C(=O)n3c(C)c(CC(=O)O)c4ccccc34)c(Cl)c2)Oc5ccccc15
Formula C28H25ClN2O5
Molecular Weight 504.96 da
Stereocenters 1/1