Target Relevance

Molecular Definition

Canonical SMILES Nc1ncnc2c1ncn2[C@@H]3O[C@H](COP(=O)(S)OCC(COP(=O)(S)OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)n5cnc6c(N)ncnc56)(COP(=O)(S)OC[C@H]7O[C@H]([C@H](O)[C@@H]7O)n8cnc9c(N)ncnc89)COP(=O)(S)OC[C@H]%10O[C@H]([C@H](O)[C@@H]%10O)n%11cnc%12c(N)ncnc%11%12)[C@@H](O)[C@H]3O
Formula C45H60N20O24P4S4
Molecular Weight 1517.23 da
Stereocenters 16/16