Target Relevance

Molecular Definition

Canonical SMILES Nc1ncnc2c1ncn2[C@@H]3O[C@H](COP(=O)(S)OCC(COP(=O)(O)S)(COP(=O)(S)OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)n5cnc6c(N)ncnc56)COP(=O)(S)OC[C@H]7O[C@H]([C@H](O)[C@@H]7O)n8cnc9c(N)ncnc89)[C@@H](O)[C@H]3O
Formula C35H49N15O21P4S4
Molecular Weight 1268.01 da
Stereocenters 12/12