Target Relevance

Molecular Definition

Canonical SMILES NS(=O)(=O)N[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O
Formula C6H14N2O7S
Molecular Weight 258.25 da
Stereocenters 5/5