Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)NC[C@H](O)c1ccc2O[B-](O)(O)OCc2c1
Formula C13H21BNO5
Molecular Weight 282.12 da
Stereocenters 1/1