Target Relevance

Molecular Definition

Canonical SMILES C[C@H]1C\C=C/C(=O)[C@@H](O)[C@@H](O)C\C=C\c2cc(O)cc(O)c2C(=O)O1
Formula C18H20O7
Molecular Weight 348.35 da
Stereocenters 3/3