Molecular Definition

Canonical SMILES CN1C(=Nc2ccc(CN(CCC#C)c3ccc(cc3)C(=O)NCc4cccnc4)cc2C1=O)C
Formula C28H27N5O2
Molecular Weight 465.55 da
Stereocenters 0/0