Molecular Definition

Canonical SMILES CN1C=Nc2cc(Cl)c(CN(C(=O)C=C(C)C)c3ccc(cc3)C(=O)NCc4cccnc4)cc2C1=O
Formula C28H26ClN5O3
Molecular Weight 515.99 da
Stereocenters 0/0