Molecular Definition

Canonical SMILES CCOc1ccc(Oc2ccc(cc2)S(=O)(=O)C3(CCN(CC3)C4CC4)C(=O)NO)cc1
Formula C23H28N2O6S
Molecular Weight 460.54 da
Stereocenters 0/0