Target Relevance

Molecular Definition

Canonical SMILES CC(N(C)C)c1cccc(c1)C#Cc2ccc3c(Cl)c(CN)sc3c2
Formula C21H21ClN2S
Molecular Weight 368.92 da
Stereocenters 0/1