Molecular Definition

Canonical SMILES Cc1onc(C)c1CCC2CCN(CC2)S(=O)(=O)CC3(CCCCC3)N(O)C=O
Formula C20H33N3O5S
Molecular Weight 427.56 da
Stereocenters 0/0