Molecular Definition

Canonical SMILES Cc1onc(C)c1CCC2CCN(CC2)S(=O)(=O)CC3(CCOCC3)N(O)C=O
Formula C19H31N3O6S
Molecular Weight 429.53 da
Stereocenters 0/0