Molecular Definition

Canonical SMILES Cc1nc(nc(Nc2ccc(cc2)C(=O)O)c1CC=C)c3cnccn3
Formula C19H17N5O2
Molecular Weight 347.37 da
Stereocenters 0/0