Molecular Definition

Canonical SMILES COC(=O)COc1cc2CCCc2c3c1c(C(=O)C(=O)N)c(C)n3Cc4ccc(F)cc4
Formula C24H23FN2O5
Molecular Weight 438.45 da
Stereocenters 0/0