Target Relevance

Molecular Definition

Canonical SMILES Cc1c2CCCN3CC[C@@H](C3)Nc4cc(ccc4C(=O)N)n2c5CC(C)(C)CC(=O)c15
Formula C25H32N4O2
Molecular Weight 420.55 da
Stereocenters 1/1