Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)N2C(=O)[C@](N3CCC[C@H]3c4occn4)(c5cc(CN6CCN(C)CC6)ccc5OC)c7cc(Cl)ccc27
Formula C35H38ClN5O6S
Molecular Weight 692.22 da
Stereocenters 2/2