Molecular Definition

Canonical SMILES Fc1cccc(c1)N(Cc2cc(F)c(F)c(F)c2)C(=O)O[C@H]3CN4CCC3CC4
Formula C21H20F4N2O2
Molecular Weight 408.39 da
Stereocenters 1/1