Molecular Definition

Canonical SMILES COc1ccccc1N2CCN(CC(F)CCNC(=O)c3cc4ccccc4[nH]3)CC2
Formula C24H29FN4O2
Molecular Weight 424.51 da
Stereocenters 0/1