Molecular Definition

Canonical SMILES Cc1cccc(Nc2ccc(cc2)c3ccc(nc3)N4CCNCC4)n1
Formula C21H23N5
Molecular Weight 345.44 da
Stereocenters 0/0