Target Relevance

Molecular Definition

Canonical SMILES Nc1ccnc(c1)c2cccc(c2)C#CCCO
Formula C15H14N2O
Molecular Weight 238.28 da
Stereocenters 0/0