Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(CC2=NN(C3CCCN(Cc4ccc(OCCCN5CCCCCC5)cc4)CC3)C(=O)c6ccccc26)cc1
Formula C37H45ClN4O2
Molecular Weight 613.23 da
Stereocenters 0/1