Molecular Definition

Canonical SMILES CN1CCC(CN2N=C(Cc3ccc(Cl)cc3)c4ccccc4C2=O)C1
Formula C21H22ClN3O
Molecular Weight 367.87 da
Stereocenters 0/1