Molecular Definition

Canonical SMILES CN(C)CCNC1=C(C)C(=O)c2sc(C)nc2C1=O
Formula C13H17N3O2S
Molecular Weight 279.36 da
Stereocenters 0/0