Target Relevance

Molecular Definition

Canonical SMILES O=S(=O)(Nc1nc(n[nH]1)C2CCC2)c3cnccc3NC4CC5CCC4C5
Formula C18H24N6O2S
Molecular Weight 388.49 da
Stereocenters 0/3