Target Relevance

Molecular Definition

Canonical SMILES CCC(C)(C)NC(=O)NS(=O)(=O)c1cnccc1N[C@@H]2C[C@H]3CC[C@@H]2C3
Formula C18H28N4O3S
Molecular Weight 380.51 da
Stereocenters 3/3