Target Relevance

Molecular Definition

Canonical SMILES OCc1ccc(COC2(N(Cc3ccc(cc3)[N+](=O)[O-])C(=O)c4ccccc24)c5ccc(Cl)cc5)cc1
Formula C29H23ClN2O5
Molecular Weight 514.96 da
Stereocenters 0/1