Target Relevance

Molecular Definition

Canonical SMILES C[C@H](N1C(=O)c2ccccc2C1(OCCCCO)c3ccc(Cl)cc3)c4ccc(Cl)cc4
Formula C26H25Cl2NO3
Molecular Weight 470.39 da
Stereocenters 1/2