Target Relevance

Molecular Definition

Canonical SMILES CN(CCCNC(=O)c1ccccc1)C(=O)c2cc3ccccc3cc2C(=O)C(c4cccc5ccccc45)P(=O)(O)O
Formula C34H31N2O6P
Molecular Weight 594.59 da
Stereocenters 0/1